C40H64B2N2 — CID 102338200
[1-[2,6-di(propan-2-yl)phenyl]-3,3,5,5-tetramethylpyrrolidin-2-yl]-[1-[2,6-di(propan-2-yl)phenyl]-3,3,5,5-tetramethylpyrrolidin-2-yl]boranylideneborane (PubChem CID 102338200) has the molecular formula C40H64B2N2 and a molecular weight of 594.59 g/mol. Its IUPAC name is [1-[2,6-di(propan-2-yl)phenyl]-3,3,5,5-tetramethylpyrrolidin-2-yl]-[1-[2,6-di(propan-2-yl)phenyl]-3,3,5,5-tetramethylpyrrolidin-2-yl]boranylideneborane.
| Compound Name | [1-[2,6-di(propan-2-yl)phenyl]-3,3,5,5-tetramethylpyrrolidin-2-yl]-[1-[2,6-di(propan-2-yl)phenyl]-3,3,5,5-tetramethylpyrrolidin-2-yl]boranylideneborane |
|---|---|
| PubChem CID | 102338200 |
| Molecular Formula | C40H64B2N2 |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 594.53 |
| IUPAC Name | [1-[2,6-di(propan-2-yl)phenyl]-3,3,5,5-tetramethylpyrrolidin-2-yl]-[1-[2,6-di(propan-2-yl)phenyl]-3,3,5,5-tetramethylpyrrolidin-2-yl]boranylideneborane |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(/B=B/C2N(c3c(C(C)C)cccc3C(C)C)C(C)(C)CC2(C)C)C(C)(C)CC1(C)C |
| InChI | InChI=1S/C40H64B2N2/c1-25(2)29-19-17-20-30(26(3)4)33(29)43-35(37(9,10)23-39(43,13)14)41-42-36-38(11,12)24-40(15,16)44(36)34-31(27(5)6)21-18-22-32(34)28(7)8/h17-22,25-28,35-36H,23-24H2,1-16H3 |
| InChIKey | NYIUHSAKVCVDJK-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|