C30H47BN2 — CID 146673220
5-[amino-(2,3,5,6-tetramethylphenyl)boranyl]-1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethylpyrrolidine (PubChem CID 146673220) has the molecular formula C30H47BN2 and a molecular weight of 446.53 g/mol. Its IUPAC name is 5-[amino-(2,3,5,6-tetramethylphenyl)boranyl]-1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethylpyrrolidine.
| Compound Name | 5-[amino-(2,3,5,6-tetramethylphenyl)boranyl]-1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethylpyrrolidine |
|---|---|
| PubChem CID | 146673220 |
| Molecular Formula | C30H47BN2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.38 |
| IUPAC Name | 5-[amino-(2,3,5,6-tetramethylphenyl)boranyl]-1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethylpyrrolidine |
| SMILES | Cc1cc(C)c(C)c(B(N)C2N(c3c(C(C)C)cccc3C(C)C)C(C)(C)CC2(C)C)c1C |
| InChI | InChI=1S/C30H47BN2/c1-18(2)24-14-13-15-25(19(3)4)27(24)33-28(29(9,10)17-30(33,11)12)31(32)26-22(7)20(5)16-21(6)23(26)8/h13-16,18-19,28H,17,32H2,1-12H3 |
| InChIKey | GWLWIPDGBBVZHP-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|