C21H32Cl3N — CID 132545970
1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethyl-5-(trichloromethyl)pyrrolidine (PubChem CID 132545970) has the molecular formula C21H32Cl3N and a molecular weight of 404.85 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethyl-5-(trichloromethyl)pyrrolidine.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethyl-5-(trichloromethyl)pyrrolidine |
|---|---|
| PubChem CID | 132545970 |
| Molecular Formula | C21H32Cl3N |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethyl-5-(trichloromethyl)pyrrolidine |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(C(Cl)(Cl)Cl)C(C)(C)CC1(C)C |
| InChI | InChI=1S/C21H32Cl3N/c1-13(2)15-10-9-11-16(14(3)4)17(15)25-18(21(22,23)24)19(5,6)12-20(25,7)8/h9-11,13-14,18H,12H2,1-8H3 |
| InChIKey | VJHVOVPPKPDZJJ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|