C23H35NS — CID 139160540
2-[2,6-di(propan-2-yl)phenyl]-3,3-dimethyl-2-azaspiro[4.5]decane-1-thione (PubChem CID 139160540) has the molecular formula C23H35NS and a molecular weight of 357.61 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)phenyl]-3,3-dimethyl-2-azaspiro[4.5]decane-1-thione.
| Compound Name | 2-[2,6-di(propan-2-yl)phenyl]-3,3-dimethyl-2-azaspiro[4.5]decane-1-thione |
|---|---|
| PubChem CID | 139160540 |
| Molecular Formula | C23H35NS |
| Molecular Weight | 357.61 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)phenyl]-3,3-dimethyl-2-azaspiro[4.5]decane-1-thione |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=S)C2(CCCCC2)CC1(C)C |
| InChI | InChI=1S/C23H35NS/c1-16(2)18-11-10-12-19(17(3)4)20(18)24-21(25)23(15-22(24,5)6)13-8-7-9-14-23/h10-12,16-17H,7-9,13-15H2,1-6H3 |
| InChIKey | SFXVACHQMZZKLG-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.61 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|