C24H38N+ — CID 122595108
2-[2,6-di(propan-2-yl)phenyl]-1,3,3-trimethyl-2-azoniaspiro[4.5]dec-1-ene (PubChem CID 122595108) has the molecular formula C24H38N+ and a molecular weight of 340.58 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)phenyl]-1,3,3-trimethyl-2-azoniaspiro[4.5]dec-1-ene.
| Compound Name | 2-[2,6-di(propan-2-yl)phenyl]-1,3,3-trimethyl-2-azoniaspiro[4.5]dec-1-ene |
|---|---|
| PubChem CID | 122595108 |
| Molecular Formula | C24H38N+ |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.30 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)phenyl]-1,3,3-trimethyl-2-azoniaspiro[4.5]dec-1-ene |
| SMILES | CC1=[N+](c2c(C(C)C)cccc2C(C)C)C(C)(C)CC12CCCCC2 |
| InChI | InChI=1S/C24H38N/c1-17(2)20-12-11-13-21(18(3)4)22(20)25-19(5)24(16-23(25,6)7)14-9-8-10-15-24/h11-13,17-18H,8-10,14-16H2,1-7H3/q+1 |
| InChIKey | HKEGHTGISGQHJK-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|