C25H38AuClN- — CID 135084941
CID 135084941 (PubChem CID 135084941) has the molecular formula C25H38AuClN- and a molecular weight of 585.01 g/mol.
| Compound Name | CID 135084941 |
|---|---|
| PubChem CID | 135084941 |
| Molecular Formula | C25H38AuClN- |
| Molecular Weight | 585.01 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | — |
| SMILES | CC1=CC(C)C2([CH-]N(c3c(C(C)C)cccc3C(C)C)C(C)(C)C2)CC1.Cl[Au] |
| InChI | InChI=1S/C25H38N.Au.ClH/c1-17(2)21-10-9-11-22(18(3)4)23(21)26-16-25(15-24(26,7)8)13-12-19(5)14-20(25)6;;/h9-11,14,16-18,20H,12-13,15H2,1-8H3;;1H/q-1;+1;/p-1 |
| InChIKey | VLVBEVBGRZMTRD-UHFFFAOYSA-M |
| XLogP | 8.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.01 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|