C20H31NP- — CID 139125846
[1-[2,6-di(propan-2-yl)phenyl]-3,3,5,5-tetramethylpyrrolidin-2-ylidene]phosphanide (PubChem CID 139125846) has the molecular formula C20H31NP- and a molecular weight of 316.45 g/mol. Its IUPAC name is [1-[2,6-di(propan-2-yl)phenyl]-3,3,5,5-tetramethylpyrrolidin-2-ylidene]phosphanide.
| Compound Name | [1-[2,6-di(propan-2-yl)phenyl]-3,3,5,5-tetramethylpyrrolidin-2-ylidene]phosphanide |
|---|---|
| PubChem CID | 139125846 |
| Molecular Formula | C20H31NP- |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | [1-[2,6-di(propan-2-yl)phenyl]-3,3,5,5-tetramethylpyrrolidin-2-ylidene]phosphanide |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=[P-])C(C)(C)CC1(C)C |
| InChI | InChI=1S/C20H31NP/c1-13(2)15-10-9-11-16(14(3)4)17(15)21-18(22)19(5,6)12-20(21,7)8/h9-11,13-14H,12H2,1-8H3/q-1 |
| InChIKey | ZXHVBOOTSPEGMZ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|