C33H48Cl2NORu- — CID 58568218
CID 58568218 (PubChem CID 58568218) has the molecular formula C33H48Cl2NORu- and a molecular weight of 646.73 g/mol.
| Compound Name | CID 58568218 |
|---|---|
| PubChem CID | 58568218 |
| Molecular Formula | C33H48Cl2NORu- |
| Molecular Weight | 646.73 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | — |
| SMILES | CC(C)Oc1ccccc1C=[Ru](Cl)Cl.CC(C)c1cccc(C(C)C)c1N1[CH-]C2(CCCCC2)CC1(C)C |
| InChI | InChI=1S/C23H36N.C10H12O.2ClH.Ru/c1-17(2)19-11-10-12-20(18(3)4)21(19)24-16-23(15-22(24,5)6)13-8-7-9-14-23;1-8(2)11-10-7-5-4-6-9(10)3;;;/h10-12,16-18H,7-9,13-15H2,1-6H3;3-8H,1-2H3;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | KHJGSGFNDUYJRS-UHFFFAOYSA-L |
| XLogP | 10.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.73 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|