About CID 58568218
CID 58568218 (PubChem CID 58568218) has the molecular formula C33H48Cl2NORu-
and a molecular weight of 646.73 g/mol.
Molecular Properties
| Compound Name | CID 58568218 |
| PubChem CID | 58568218 |
| Molecular Formula | C33H48Cl2NORu- |
| Molecular Weight | 646.73 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | — |
| SMILES | CC(C)Oc1ccccc1C=[Ru](Cl)Cl.CC(C)c1cccc(C(C)C)c1N1[CH-]C2(CCCCC2)CC1(C)C |
| InChI | InChI=1S/C23H36N.C10H12O.2ClH.Ru/c1-17(2)19-11-10-12-20(18(3)4)21(19)24-16-23(15-22(24,5)6)13-8-7-9-14-23;1-8(2)11-10-7-5-4-6-9(10)3;;;/h10-12,16-18H,7-9,13-15H2,1-6H3;3-8H,1-2H3;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | KHJGSGFNDUYJRS-UHFFFAOYSA-L |
| XLogP | 10.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 646.73 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 58568218 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58568218?
The IUPAC name of CID 58568218 (CID 58568218) is not available.
What is the SMILES notation for CID 58568218?
The canonical SMILES for CID 58568218 is CC(C)Oc1ccccc1C=[Ru](Cl)Cl.CC(C)c1cccc(C(C)C)c1N1[CH-]C2(CCCCC2)CC1(C)C.
What is the InChIKey of CID 58568218?
The InChIKey is KHJGSGFNDUYJRS-UHFFFAOYSA-L. The full InChI is InChI=1S/C23H36N.C10H12O.2ClH.Ru/c1-17(2)19-11-10-12-20(18(3)4)21(19)24-16-23(15-22(24,5)6)13-8-7-9-14-23;1-8(2)11-10-7-5-4-6-9(10)3;;;/h10-12,16-18H,7-9,13-15H2,1-6H3;3-8H,1-2H3;2*1H;/q-1;;;;+2/p-2.
What are the key properties of CID 58568218?
CID 58568218 has a molecular weight of 646.73 g/mol, XLogP of 10.58, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58568218 is sourced from PubChem (CID 58568218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).