C32H42Cl2NO2Ru- — CID 156681908
dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;N-[[2,6-di(propan-2-yl)phenoxy]methyl]-N-propan-2-ylaniline (PubChem CID 156681908) has the molecular formula C32H42Cl2NO2Ru- and a molecular weight of 644.67 g/mol. Its IUPAC name is dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;N-[[2,6-di(propan-2-yl)phenoxy]methyl]-N-propan-2-ylaniline.
| Compound Name | dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;N-[[2,6-di(propan-2-yl)phenoxy]methyl]-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 156681908 |
| Molecular Formula | C32H42Cl2NO2Ru- |
| Molecular Weight | 644.67 g/mol |
| Exact Mass | 644.16 |
| IUPAC Name | dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;N-[[2,6-di(propan-2-yl)phenoxy]methyl]-N-propan-2-ylaniline |
| SMILES | CC(C)Oc1ccccc1C=[Ru](Cl)Cl.CC(C)c1cccc(C(C)C)c1O[CH-]N(c1ccccc1)C(C)C |
| InChI | InChI=1S/C22H30NO.C10H12O.2ClH.Ru/c1-16(2)20-13-10-14-21(17(3)4)22(20)24-15-23(18(5)6)19-11-8-7-9-12-19;1-8(2)11-10-7-5-4-6-9(10)3;;;/h7-18H,1-6H3;3-8H,1-2H3;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | XMJPUNVVDWXQKW-UHFFFAOYSA-L |
| XLogP | 9.90 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.67 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|