C11H14Cl2O2Ru — CID 153434955
dichloro-[(5-methoxy-2-propan-2-yloxyphenyl)methylidene]ruthenium (PubChem CID 153434955) has the molecular formula C11H14Cl2O2Ru and a molecular weight of 350.21 g/mol. Its IUPAC name is dichloro-[(5-methoxy-2-propan-2-yloxyphenyl)methylidene]ruthenium.
| Compound Name | dichloro-[(5-methoxy-2-propan-2-yloxyphenyl)methylidene]ruthenium |
|---|---|
| PubChem CID | 153434955 |
| Molecular Formula | C11H14Cl2O2Ru |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.94 |
| IUPAC Name | dichloro-[(5-methoxy-2-propan-2-yloxyphenyl)methylidene]ruthenium |
| SMILES | COc1ccc(OC(C)C)c(C=[Ru](Cl)Cl)c1 |
| InChI | InChI=1S/C11H14O2.2ClH.Ru/c1-8(2)13-11-6-5-10(12-4)7-9(11)3;;;/h3,5-8H,1-2,4H3;2*1H;/q;;;+2/p-2 |
| InChIKey | SRBGODNXWGDNLW-UHFFFAOYSA-L |
| XLogP | 3.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |