C17H24Cl2O3RuSi — CID 58112670
CID 58112670 (PubChem CID 58112670) has the molecular formula C17H24Cl2O3RuSi and a molecular weight of 476.44 g/mol.
| Compound Name | CID 58112670 |
|---|---|
| PubChem CID | 58112670 |
| Molecular Formula | C17H24Cl2O3RuSi |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | — |
| SMILES | C[Si]CCCCC(=O)OCc1ccc(OC(C)C)c(C=[Ru](Cl)Cl)c1 |
| InChI | InChI=1S/C17H24O3Si.2ClH.Ru/c1-13(2)20-16-9-8-15(11-14(16)3)12-19-17(18)7-5-6-10-21-4;;;/h3,8-9,11,13H,5-7,10,12H2,1-2,4H3;2*1H;/q;;;+2/p-2 |
| InChIKey | AZIGTKRPVRYRBQ-UHFFFAOYSA-L |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|