C14H22Cl2NORu+ — CID 167346276
dichloro-[[2-propan-2-yloxy-5-[(trimethylazaniumyl)methyl]phenyl]methylidene]ruthenium (PubChem CID 167346276) has the molecular formula C14H22Cl2NORu+ and a molecular weight of 392.31 g/mol. Its IUPAC name is dichloro-[[2-propan-2-yloxy-5-[(trimethylazaniumyl)methyl]phenyl]methylidene]ruthenium.
| Compound Name | dichloro-[[2-propan-2-yloxy-5-[(trimethylazaniumyl)methyl]phenyl]methylidene]ruthenium |
|---|---|
| PubChem CID | 167346276 |
| Molecular Formula | C14H22Cl2NORu+ |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | dichloro-[[2-propan-2-yloxy-5-[(trimethylazaniumyl)methyl]phenyl]methylidene]ruthenium |
| SMILES | CC(C)Oc1ccc(C[N+](C)(C)C)cc1C=[Ru](Cl)Cl |
| InChI | InChI=1S/C14H22NO.2ClH.Ru/c1-11(2)16-14-8-7-13(9-12(14)3)10-15(4,5)6;;;/h3,7-9,11H,10H2,1-2,4-6H3;2*1H;/q+1;;;+2/p-2 |
| InChIKey | WEYYIKMQEGQAKZ-UHFFFAOYSA-L |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|