C31H52Cl2O2PRu+ — CID 59117453
dichloro-[[2,5-di(propan-2-yloxy)phenyl]methylidene]ruthenium;tricyclohexylphosphanium (PubChem CID 59117453) has the molecular formula C31H52Cl2O2PRu+ and a molecular weight of 659.71 g/mol. Its IUPAC name is dichloro-[[2,5-di(propan-2-yloxy)phenyl]methylidene]ruthenium;tricyclohexylphosphanium.
| Compound Name | dichloro-[[2,5-di(propan-2-yloxy)phenyl]methylidene]ruthenium;tricyclohexylphosphanium |
|---|---|
| PubChem CID | 59117453 |
| Molecular Formula | C31H52Cl2O2PRu+ |
| Molecular Weight | 659.71 g/mol |
| Exact Mass | 659.21 |
| IUPAC Name | dichloro-[[2,5-di(propan-2-yloxy)phenyl]methylidene]ruthenium;tricyclohexylphosphanium |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.CC(C)Oc1ccc(OC(C)C)c(C=[Ru](Cl)Cl)c1 |
| InChI | InChI=1S/C18H33P.C13H18O2.2ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-9(2)14-12-6-7-13(11(5)8-12)15-10(3)4;;;/h16-18H,1-15H2;5-10H,1-4H3;2*1H;/q;;;;+2/p-1 |
| InChIKey | AMMZURVQOBBGHD-UHFFFAOYSA-M |
| XLogP | 10.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.71 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|