C13H11Cl2F7ORuS — CID 135024694
dichloro-[[5-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-propan-2-yloxyphenyl]methylidene]ruthenium (PubChem CID 135024694) has the molecular formula C13H11Cl2F7ORuS and a molecular weight of 520.26 g/mol. Its IUPAC name is dichloro-[[5-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-propan-2-yloxyphenyl]methylidene]ruthenium.
| Compound Name | dichloro-[[5-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-propan-2-yloxyphenyl]methylidene]ruthenium |
|---|---|
| PubChem CID | 135024694 |
| Molecular Formula | C13H11Cl2F7ORuS |
| Molecular Weight | 520.26 g/mol |
| Exact Mass | 519.88 |
| IUPAC Name | dichloro-[[5-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-propan-2-yloxyphenyl]methylidene]ruthenium |
| SMILES | CC(C)Oc1ccc(SC(F)(F)C(F)(F)C(F)(F)F)cc1C=[Ru](Cl)Cl |
| InChI | InChI=1S/C13H11F7OS.2ClH.Ru/c1-7(2)21-10-5-4-9(6-8(10)3)22-13(19,20)11(14,15)12(16,17)18;;;/h3-7H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | NKDXMWSWLFZCAS-UHFFFAOYSA-L |
| XLogP | 6.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.26 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|