C13H12Cl2F3NO3Ru — CID 59273372
dichloro-[[2-propan-2-yloxy-5-[(3,3,3-trifluoro-2-oxopropanoyl)amino]phenyl]methylidene]ruthenium (PubChem CID 59273372) has the molecular formula C13H12Cl2F3NO3Ru and a molecular weight of 459.21 g/mol. Its IUPAC name is dichloro-[[2-propan-2-yloxy-5-[(3,3,3-trifluoro-2-oxopropanoyl)amino]phenyl]methylidene]ruthenium.
| Compound Name | dichloro-[[2-propan-2-yloxy-5-[(3,3,3-trifluoro-2-oxopropanoyl)amino]phenyl]methylidene]ruthenium |
|---|---|
| PubChem CID | 59273372 |
| Molecular Formula | C13H12Cl2F3NO3Ru |
| Molecular Weight | 459.21 g/mol |
| Exact Mass | 458.92 |
| IUPAC Name | dichloro-[[2-propan-2-yloxy-5-[(3,3,3-trifluoro-2-oxopropanoyl)amino]phenyl]methylidene]ruthenium |
| SMILES | CC(C)Oc1ccc(NC(=O)C(=O)C(F)(F)F)cc1C=[Ru](Cl)Cl |
| InChI | InChI=1S/C13H12F3NO3.2ClH.Ru/c1-7(2)20-10-5-4-9(6-8(10)3)17-12(19)11(18)13(14,15)16;;;/h3-7H,1-2H3,(H,17,19);2*1H;/q;;;+2/p-2 |
| InChIKey | KLHVMLAQJRGLIZ-UHFFFAOYSA-L |
| XLogP | 3.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.21 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|