About carbanide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium
carbanide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium (PubChem CID 20816790) has the molecular formula C11H15Cl2ORu-
and a molecular weight of 335.22 g/mol. Its IUPAC name is carbanide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium.
Molecular Properties
| Compound Name | carbanide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium |
| PubChem CID | 20816790 |
| Molecular Formula | C11H15Cl2ORu- |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | carbanide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium |
| SMILES | CC(C)Oc1ccccc1C=[Ru](Cl)Cl.[CH3-] |
| InChI | InChI=1S/C10H12O.CH3.2ClH.Ru/c1-8(2)11-10-7-5-4-6-9(10)3;;;;/h3-8H,1-2H3;1H3;2*1H;/q;-1;;;+2/p-2 |
| InChIKey | OUTJCXGHEQFMIA-UHFFFAOYSA-L |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium?
The IUPAC name of carbanide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium (CID 20816790) is carbanide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium.
What is the SMILES notation for carbanide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium?
The canonical SMILES for carbanide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium is CC(C)Oc1ccccc1C=[Ru](Cl)Cl.[CH3-].
What is the InChIKey of carbanide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium?
The InChIKey is OUTJCXGHEQFMIA-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H12O.CH3.2ClH.Ru/c1-8(2)11-10-7-5-4-6-9(10)3;;;;/h3-8H,1-2H3;1H3;2*1H;/q;-1;;;+2/p-2.
What are the key properties of carbanide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium?
carbanide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium has a molecular weight of 335.22 g/mol, XLogP of 4.00, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium is sourced from PubChem (CID 20816790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).