About 1-methyl-2-propan-2-yloxybenzene;trichlororuthenium
1-methyl-2-propan-2-yloxybenzene;trichlororuthenium (PubChem CID 175208112) has the molecular formula C10H14Cl3ORu
and a molecular weight of 357.65 g/mol. Its IUPAC name is 1-methyl-2-propan-2-yloxybenzene;trichlororuthenium.
Molecular Properties
| Compound Name | 1-methyl-2-propan-2-yloxybenzene;trichlororuthenium |
| PubChem CID | 175208112 |
| Molecular Formula | C10H14Cl3ORu |
| Molecular Weight | 357.65 g/mol |
| Exact Mass | 356.92 |
| IUPAC Name | 1-methyl-2-propan-2-yloxybenzene;trichlororuthenium |
| SMILES | Cc1ccccc1OC(C)C.Cl[Ru](Cl)Cl |
| InChI | InChI=1S/C10H14O.3ClH.Ru/c1-8(2)11-10-7-5-4-6-9(10)3;;;;/h4-8H,1-3H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | IUOWRMPRGJXBSB-UHFFFAOYSA-K |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-2-propan-2-yloxybenzene;trichlororuthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-propan-2-yloxybenzene;trichlororuthenium?
The IUPAC name of 1-methyl-2-propan-2-yloxybenzene;trichlororuthenium (CID 175208112) is 1-methyl-2-propan-2-yloxybenzene;trichlororuthenium.
What is the SMILES notation for 1-methyl-2-propan-2-yloxybenzene;trichlororuthenium?
The canonical SMILES for 1-methyl-2-propan-2-yloxybenzene;trichlororuthenium is Cc1ccccc1OC(C)C.Cl[Ru](Cl)Cl.
What is the InChIKey of 1-methyl-2-propan-2-yloxybenzene;trichlororuthenium?
The InChIKey is IUOWRMPRGJXBSB-UHFFFAOYSA-K. The full InChI is InChI=1S/C10H14O.3ClH.Ru/c1-8(2)11-10-7-5-4-6-9(10)3;;;;/h4-8H,1-3H3;3*1H;/q;;;;+3/p-3.
What are the key properties of 1-methyl-2-propan-2-yloxybenzene;trichlororuthenium?
1-methyl-2-propan-2-yloxybenzene;trichlororuthenium has a molecular weight of 357.65 g/mol, XLogP of 4.85, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-propan-2-yloxybenzene;trichlororuthenium is sourced from PubChem (CID 175208112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).