C16H19O2P — CID 175048136
2,2-bis(2-methylphenoxy)ethylphosphane (PubChem CID 175048136) has the molecular formula C16H19O2P and a molecular weight of 274.30 g/mol. Its IUPAC name is 2,2-bis(2-methylphenoxy)ethylphosphane.
| Compound Name | 2,2-bis(2-methylphenoxy)ethylphosphane |
|---|---|
| PubChem CID | 175048136 |
| Molecular Formula | C16H19O2P |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2,2-bis(2-methylphenoxy)ethylphosphane |
| SMILES | Cc1ccccc1OC(CP)Oc1ccccc1C |
| InChI | InChI=1S/C16H19O2P/c1-12-7-3-5-9-14(12)17-16(11-19)18-15-10-6-4-8-13(15)2/h3-10,16H,11,19H2,1-2H3 |
| InChIKey | CQXZYKIDYABKJP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|