About CID 174286143
CID 174286143 (PubChem CID 174286143) has the molecular formula C21H21BO3P+
and a molecular weight of 363.18 g/mol.
Molecular Properties
| Compound Name | CID 174286143 |
| PubChem CID | 174286143 |
| Molecular Formula | C21H21BO3P+ |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | — |
| SMILES | [B][P+](Oc1ccccc1C)(Oc1ccccc1C)Oc1ccccc1C |
| InChI | InChI=1S/C21H21BO3P/c1-16-10-4-7-13-19(16)23-26(22,24-20-14-8-5-11-17(20)2)25-21-15-9-6-12-18(21)3/h4-15H,1-3H3/q+1 |
| InChIKey | FHAXGTPBWHFGLL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 174286143 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174286143?
The IUPAC name of CID 174286143 (CID 174286143) is not available.
What is the SMILES notation for CID 174286143?
The canonical SMILES for CID 174286143 is [B][P+](Oc1ccccc1C)(Oc1ccccc1C)Oc1ccccc1C.
What is the InChIKey of CID 174286143?
The InChIKey is FHAXGTPBWHFGLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21BO3P/c1-16-10-4-7-13-19(16)23-26(22,24-20-14-8-5-11-17(20)2)25-21-15-9-6-12-18(21)3/h4-15H,1-3H3/q+1.
What are the key properties of CID 174286143?
CID 174286143 has a molecular weight of 363.18 g/mol, XLogP of 5.99, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174286143 is sourced from PubChem (CID 174286143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).