About 1-methyl-2-[(E,2R)-pent-3-en-2-yl]oxybenzene
1-methyl-2-[(E,2R)-pent-3-en-2-yl]oxybenzene (PubChem CID 125475972) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-methyl-2-[(E,2R)-pent-3-en-2-yl]oxybenzene.
Molecular Properties
| Compound Name | 1-methyl-2-[(E,2R)-pent-3-en-2-yl]oxybenzene |
| PubChem CID | 125475972 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 1-methyl-2-[(E,2R)-pent-3-en-2-yl]oxybenzene |
| SMILES | C/C=C/[C@@H](C)Oc1ccccc1C |
| InChI | InChI=1S/C12H16O/c1-4-7-11(3)13-12-9-6-5-8-10(12)2/h4-9,11H,1-3H3/b7-4+/t11-/m1/s1 |
| InChIKey | GDLMOKMCVWYGHS-TZOMUSMUSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-[(E,2R)-pent-3-en-2-yl]oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-[(E,2R)-pent-3-en-2-yl]oxybenzene?
The IUPAC name of 1-methyl-2-[(E,2R)-pent-3-en-2-yl]oxybenzene (CID 125475972) is 1-methyl-2-[(E,2R)-pent-3-en-2-yl]oxybenzene.
What is the SMILES notation for 1-methyl-2-[(E,2R)-pent-3-en-2-yl]oxybenzene?
The canonical SMILES for 1-methyl-2-[(E,2R)-pent-3-en-2-yl]oxybenzene is C/C=C/[C@@H](C)Oc1ccccc1C.
What is the InChIKey of 1-methyl-2-[(E,2R)-pent-3-en-2-yl]oxybenzene?
The InChIKey is GDLMOKMCVWYGHS-TZOMUSMUSA-N. The full InChI is InChI=1S/C12H16O/c1-4-7-11(3)13-12-9-6-5-8-10(12)2/h4-9,11H,1-3H3/b7-4+/t11-/m1/s1.
What are the key properties of 1-methyl-2-[(E,2R)-pent-3-en-2-yl]oxybenzene?
1-methyl-2-[(E,2R)-pent-3-en-2-yl]oxybenzene has a molecular weight of 176.26 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-[(E,2R)-pent-3-en-2-yl]oxybenzene is sourced from PubChem (CID 125475972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).