C21H21Cl2O3P-2 — CID 23333528
tris(2-methylphenyl) phosphite dichloride (PubChem CID 23333528) has the molecular formula C21H21Cl2O3P-2 and a molecular weight of 423.28 g/mol. Its IUPAC name is tris(2-methylphenyl) phosphite dichloride.
| Compound Name | tris(2-methylphenyl) phosphite dichloride |
|---|---|
| PubChem CID | 23333528 |
| Molecular Formula | C21H21Cl2O3P-2 |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | tris(2-methylphenyl) phosphite dichloride |
| SMILES | Cc1ccccc1OP(Oc1ccccc1C)Oc1ccccc1C.[Cl-].[Cl-] |
| InChI | InChI=1S/C21H21O3P.2ClH/c1-16-10-4-7-13-19(16)22-25(23-20-14-8-5-11-17(20)2)24-21-15-9-6-12-18(21)3;;/h4-15H,1-3H3;2*1H/p-2 |
| InChIKey | DBLLQROLCMTZJP-UHFFFAOYSA-L |
| XLogP | 0.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|