C33H36Cl2NORu- — CID 168890158
CID 168890158 (PubChem CID 168890158) has the molecular formula C33H36Cl2NORu- and a molecular weight of 634.63 g/mol.
| Compound Name | CID 168890158 |
|---|---|
| PubChem CID | 168890158 |
| Molecular Formula | C33H36Cl2NORu- |
| Molecular Weight | 634.63 g/mol |
| Exact Mass | 634.12 |
| IUPAC Name | — |
| SMILES | CC(C)N1[CH-]C23C(=CC(c4ccccc42)c2ccccc23)C1(C)C.CC(C)Oc1ccccc1C=[Ru](Cl)Cl |
| InChI | InChI=1S/C23H24N.C10H12O.2ClH.Ru/c1-15(2)24-14-23-19-11-7-5-9-16(19)18(13-21(23)22(24,3)4)17-10-6-8-12-20(17)23;1-8(2)11-10-7-5-4-6-9(10)3;;;/h5-15,18H,1-4H3;3-8H,1-2H3;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | TZOVNAJNLQSSML-UHFFFAOYSA-L |
| XLogP | 8.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.63 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|