C23H31Cl2N2ORu- — CID 20767012
dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;1-methyl-3-(2,4,6-trimethylphenyl)imidazolidin-2-ide (PubChem CID 20767012) has the molecular formula C23H31Cl2N2ORu- and a molecular weight of 523.49 g/mol. Its IUPAC name is dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;1-methyl-3-(2,4,6-trimethylphenyl)imidazolidin-2-ide.
| Compound Name | dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;1-methyl-3-(2,4,6-trimethylphenyl)imidazolidin-2-ide |
|---|---|
| PubChem CID | 20767012 |
| Molecular Formula | C23H31Cl2N2ORu- |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;1-methyl-3-(2,4,6-trimethylphenyl)imidazolidin-2-ide |
| SMILES | CC(C)Oc1ccccc1C=[Ru](Cl)Cl.Cc1cc(C)c(N2[CH-]N(C)CC2)c(C)c1 |
| InChI | InChI=1S/C13H19N2.C10H12O.2ClH.Ru/c1-10-7-11(2)13(12(3)8-10)15-6-5-14(4)9-15;1-8(2)11-10-7-5-4-6-9(10)3;;;/h7-9H,5-6H2,1-4H3;3-8H,1-2H3;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | RLUGGLSBDKVUAU-UHFFFAOYSA-L |
| XLogP | 6.03 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|