C29H35Cl2N2ORu- — CID 153489728
1-benzyl-3-(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium (PubChem CID 153489728) has the molecular formula C29H35Cl2N2ORu- and a molecular weight of 599.59 g/mol. Its IUPAC name is 1-benzyl-3-(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium.
| Compound Name | 1-benzyl-3-(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium |
|---|---|
| PubChem CID | 153489728 |
| Molecular Formula | C29H35Cl2N2ORu- |
| Molecular Weight | 599.59 g/mol |
| Exact Mass | 599.12 |
| IUPAC Name | 1-benzyl-3-(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium |
| SMILES | CC(C)Oc1ccccc1C=[Ru](Cl)Cl.Cc1cc(C)c(N2[CH-]N(Cc3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C19H23N2.C10H12O.2ClH.Ru/c1-15-11-16(2)19(17(3)12-15)21-10-9-20(14-21)13-18-7-5-4-6-8-18;1-8(2)11-10-7-5-4-6-9(10)3;;;/h4-8,11-12,14H,9-10,13H2,1-3H3;3-8H,1-2H3;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | AAJRSGUIVRKLPS-UHFFFAOYSA-L |
| XLogP | 7.60 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.59 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|