C31H37Cl2N2ORu- — CID 176633481
1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[(2-cyclopropyloxyphenyl)methylidene]ruthenium (PubChem CID 176633481) has the molecular formula C31H37Cl2N2ORu- and a molecular weight of 625.63 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[(2-cyclopropyloxyphenyl)methylidene]ruthenium.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[(2-cyclopropyloxyphenyl)methylidene]ruthenium |
|---|---|
| PubChem CID | 176633481 |
| Molecular Formula | C31H37Cl2N2ORu- |
| Molecular Weight | 625.63 g/mol |
| Exact Mass | 625.13 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[(2-cyclopropyloxyphenyl)methylidene]ruthenium |
| SMILES | Cc1cc(C)c(N2[CH-]N(c3c(C)cc(C)cc3C)CC2)c(C)c1.Cl[Ru](Cl)=Cc1ccccc1OC1CC1 |
| InChI | InChI=1S/C21H27N2.C10H10O.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-8-4-2-3-5-10(8)11-9-6-7-9;;;/h9-13H,7-8H2,1-6H3;1-5,9H,6-7H2;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | JSGXJNLVWJAQFC-UHFFFAOYSA-L |
| XLogP | 8.29 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.63 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|