C34H44Cl2N3ORu- — CID 140615592
1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[[2-(1-methylpiperidin-4-yl)oxyphenyl]methylidene]ruthenium (PubChem CID 140615592) has the molecular formula C34H44Cl2N3ORu- and a molecular weight of 682.72 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[[2-(1-methylpiperidin-4-yl)oxyphenyl]methylidene]ruthenium.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[[2-(1-methylpiperidin-4-yl)oxyphenyl]methylidene]ruthenium |
|---|---|
| PubChem CID | 140615592 |
| Molecular Formula | C34H44Cl2N3ORu- |
| Molecular Weight | 682.72 g/mol |
| Exact Mass | 682.19 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[[2-(1-methylpiperidin-4-yl)oxyphenyl]methylidene]ruthenium |
| SMILES | CN1CCC(Oc2ccccc2C=[Ru](Cl)Cl)CC1.Cc1cc(C)c(N2[CH-]N(c3c(C)cc(C)cc3C)CC2)c(C)c1 |
| InChI | InChI=1S/C21H27N2.C13H17NO.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-11-5-3-4-6-13(11)15-12-7-9-14(2)10-8-12;;;/h9-13H,7-8H2,1-6H3;1,3-6,12H,7-10H2,2H3;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | WXBRNOFQKMGSGK-UHFFFAOYSA-L |
| XLogP | 8.22 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.72 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|