C30H37N2ORu — CID 58568261
1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;(2-ethoxyphenyl)methylideneruthenium(1+) (PubChem CID 58568261) has the molecular formula C30H37N2ORu and a molecular weight of 542.71 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;(2-ethoxyphenyl)methylideneruthenium(1+).
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;(2-ethoxyphenyl)methylideneruthenium(1+) |
|---|---|
| PubChem CID | 58568261 |
| Molecular Formula | C30H37N2ORu |
| Molecular Weight | 542.71 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;(2-ethoxyphenyl)methylideneruthenium(1+) |
| SMILES | CCOc1ccccc1C=[Ru+].Cc1cc(C)c(N2[CH-]N(c3c(C)cc(C)cc3C)CC2)c(C)c1 |
| InChI | InChI=1S/C21H27N2.C9H10O.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-3-10-9-7-5-4-6-8(9)2;/h9-13H,7-8H2,1-6H3;2,4-7H,3H2,1H3;/q-1;;+1 |
| InChIKey | VZGHROVMZIAOKP-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.71 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|