C20H25ClO4 — CID 2283038
1-chloro-2-[2-[2-(2-ethoxyphenoxy)ethoxy]ethoxy]-3,5-dimethylbenzene (PubChem CID 2283038) has the molecular formula C20H25ClO4 and a molecular weight of 364.87 g/mol. Its IUPAC name is 1-chloro-2-[2-[2-(2-ethoxyphenoxy)ethoxy]ethoxy]-3,5-dimethylbenzene.
| Compound Name | 1-chloro-2-[2-[2-(2-ethoxyphenoxy)ethoxy]ethoxy]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 2283038 |
| Molecular Formula | C20H25ClO4 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-chloro-2-[2-[2-(2-ethoxyphenoxy)ethoxy]ethoxy]-3,5-dimethylbenzene |
| SMILES | CCOc1ccccc1OCCOCCOc1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C20H25ClO4/c1-4-23-18-7-5-6-8-19(18)24-11-9-22-10-12-25-20-16(3)13-15(2)14-17(20)21/h5-8,13-14H,4,9-12H2,1-3H3 |
| InChIKey | ZQZAJVSCWBYINP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|