C16H27ClNO+ — CID 2262334
4-(2-chloro-4,6-dimethylphenoxy)butyl-diethylazanium (PubChem CID 2262334) has the molecular formula C16H27ClNO+ and a molecular weight of 284.85 g/mol. Its IUPAC name is 4-(2-chloro-4,6-dimethylphenoxy)butyl-diethylazanium.
| Compound Name | 4-(2-chloro-4,6-dimethylphenoxy)butyl-diethylazanium |
|---|---|
| PubChem CID | 2262334 |
| Molecular Formula | C16H27ClNO+ |
| Molecular Weight | 284.85 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 4-(2-chloro-4,6-dimethylphenoxy)butyl-diethylazanium |
| SMILES | CC[NH+](CC)CCCCOc1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C16H26ClNO/c1-5-18(6-2)9-7-8-10-19-16-14(4)11-13(3)12-15(16)17/h11-12H,5-10H2,1-4H3/p+1 |
| InChIKey | CCQLNYXRJVFHLU-UHFFFAOYSA-O |
| XLogP | 3.04 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.85 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|