C36H40Cl2N3Ru- — CID 58543538
1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[[2-[(4-methylphenyl)iminomethyl]phenyl]methylidene]ruthenium (PubChem CID 58543538) has the molecular formula C36H40Cl2N3Ru- and a molecular weight of 686.71 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[[2-[(4-methylphenyl)iminomethyl]phenyl]methylidene]ruthenium.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[[2-[(4-methylphenyl)iminomethyl]phenyl]methylidene]ruthenium |
|---|---|
| PubChem CID | 58543538 |
| Molecular Formula | C36H40Cl2N3Ru- |
| Molecular Weight | 686.71 g/mol |
| Exact Mass | 686.16 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[[2-[(4-methylphenyl)iminomethyl]phenyl]methylidene]ruthenium |
| SMILES | Cc1cc(C)c(N2[CH-]N(c3c(C)cc(C)cc3C)CC2)c(C)c1.Cc1ccc(/N=C/c2ccccc2C=[Ru](Cl)Cl)cc1 |
| InChI | InChI=1S/C21H27N2.C15H13N.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-12-7-9-15(10-8-12)16-11-14-6-4-3-5-13(14)2;;;/h9-13H,7-8H2,1-6H3;2-11H,1H3;2*1H;/q-1;;;;+2/p-2/b;16-11+;;; |
| InChIKey | TWLVQBYCPITVQM-MODNZHRCSA-L |
| XLogP | 9.80 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.71 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|