C21H27Cl2NORu — CID 58307770
dichloro-[(2-methyloxoniophenyl)methylidene]ruthenium;1-(2,4,6-trimethylphenyl)pyrrolidin-5-ide (PubChem CID 58307770) has the molecular formula C21H27Cl2NORu and a molecular weight of 481.43 g/mol. Its IUPAC name is dichloro-[(2-methyloxoniophenyl)methylidene]ruthenium;1-(2,4,6-trimethylphenyl)pyrrolidin-5-ide.
| Compound Name | dichloro-[(2-methyloxoniophenyl)methylidene]ruthenium;1-(2,4,6-trimethylphenyl)pyrrolidin-5-ide |
|---|---|
| PubChem CID | 58307770 |
| Molecular Formula | C21H27Cl2NORu |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | dichloro-[(2-methyloxoniophenyl)methylidene]ruthenium;1-(2,4,6-trimethylphenyl)pyrrolidin-5-ide |
| SMILES | C[OH+]c1ccccc1C=[Ru](Cl)Cl.Cc1cc(C)c(N2[CH-]CCC2)c(C)c1 |
| InChI | InChI=1S/C13H18N.C8H8O.2ClH.Ru/c1-10-8-11(2)13(12(3)9-10)14-6-4-5-7-14;1-7-5-3-4-6-8(7)9-2;;;/h6,8-9H,4-5,7H2,1-3H3;1,3-6H,2H3;2*1H;/q-1;;;;+2/p-1 |
| InChIKey | YZPPJZJZWICYPG-UHFFFAOYSA-M |
| XLogP | 6.01 |
| TPSA | 16.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|