C39H56Cl2IN4ORu- — CID 157075955
4-[[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-id-4-yl]methyl]-1-ethyl-1-methylpiperazin-1-ium;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;iodide (PubChem CID 157075955) has the molecular formula C39H56Cl2IN4ORu- and a molecular weight of 895.78 g/mol. Its IUPAC name is 4-[[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-id-4-yl]methyl]-1-ethyl-1-methylpiperazin-1-ium;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;iodide.
| Compound Name | 4-[[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-id-4-yl]methyl]-1-ethyl-1-methylpiperazin-1-ium;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;iodide |
|---|---|
| PubChem CID | 157075955 |
| Molecular Formula | C39H56Cl2IN4ORu- |
| Molecular Weight | 895.78 g/mol |
| Exact Mass | 895.19 |
| IUPAC Name | 4-[[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-id-4-yl]methyl]-1-ethyl-1-methylpiperazin-1-ium;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;iodide |
| SMILES | CC(C)Oc1ccccc1C=[Ru](Cl)Cl.CC[N+]1(C)CCN(CC2CN(c3c(C)cc(C)cc3C)[CH-]N2c2c(C)cc(C)cc2C)CC1.[I-] |
| InChI | InChI=1S/C29H44N4.C10H12O.2ClH.HI.Ru/c1-9-33(8)12-10-30(11-13-33)18-27-19-31(28-23(4)14-21(2)15-24(28)5)20-32(27)29-25(6)16-22(3)17-26(29)7;1-8(2)11-10-7-5-4-6-9(10)3;;;;/h14-17,20,27H,9-13,18-19H2,1-8H3;3-8H,1-2H3;3*1H;/q;;;;;+2/p-3 |
| InChIKey | YCWQOUUNVMRXCF-UHFFFAOYSA-K |
| XLogP | 5.69 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.78 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|