C39H53BrCl2N3O2Ru- — CID 140795765
5-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-id-4-yl]-4-bromo-N,2,2-trimethylpentanamide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium (PubChem CID 140795765) has the molecular formula C39H53BrCl2N3O2Ru- and a molecular weight of 847.75 g/mol. Its IUPAC name is 5-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-id-4-yl]-4-bromo-N,2,2-trimethylpentanamide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium.
| Compound Name | 5-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-id-4-yl]-4-bromo-N,2,2-trimethylpentanamide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium |
|---|---|
| PubChem CID | 140795765 |
| Molecular Formula | C39H53BrCl2N3O2Ru- |
| Molecular Weight | 847.75 g/mol |
| Exact Mass | 846.17 |
| IUPAC Name | 5-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-id-4-yl]-4-bromo-N,2,2-trimethylpentanamide;dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium |
| SMILES | CC(C)Oc1ccccc1C=[Ru](Cl)Cl.CNC(=O)C(C)(C)CC(Br)CC1CN(c2c(C)cc(C)cc2C)[CH-]N1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C29H41BrN3O.C10H12O.2ClH.Ru/c1-18-10-20(3)26(21(4)11-18)32-16-25(14-24(30)15-29(7,8)28(34)31-9)33(17-32)27-22(5)12-19(2)13-23(27)6;1-8(2)11-10-7-5-4-6-9(10)3;;;/h10-13,17,24-25H,14-16H2,1-9H3,(H,31,34);3-8H,1-2H3;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | NATKVYBBQHFSHK-UHFFFAOYSA-L |
| XLogP | 10.22 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.75 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|