C14H11Cl2F4NO3Ru — CID 59273370
dichloro-[[2-propan-2-yloxy-5-(3,3,4,4-tetrafluoro-2,5-dioxopyrrolidin-1-yl)phenyl]methylidene]ruthenium (PubChem CID 59273370) has the molecular formula C14H11Cl2F4NO3Ru and a molecular weight of 489.21 g/mol. Its IUPAC name is dichloro-[[2-propan-2-yloxy-5-(3,3,4,4-tetrafluoro-2,5-dioxopyrrolidin-1-yl)phenyl]methylidene]ruthenium.
| Compound Name | dichloro-[[2-propan-2-yloxy-5-(3,3,4,4-tetrafluoro-2,5-dioxopyrrolidin-1-yl)phenyl]methylidene]ruthenium |
|---|---|
| PubChem CID | 59273370 |
| Molecular Formula | C14H11Cl2F4NO3Ru |
| Molecular Weight | 489.21 g/mol |
| Exact Mass | 488.91 |
| IUPAC Name | dichloro-[[2-propan-2-yloxy-5-(3,3,4,4-tetrafluoro-2,5-dioxopyrrolidin-1-yl)phenyl]methylidene]ruthenium |
| SMILES | CC(C)Oc1ccc(N2C(=O)C(F)(F)C(F)(F)C2=O)cc1C=[Ru](Cl)Cl |
| InChI | InChI=1S/C14H11F4NO3.2ClH.Ru/c1-7(2)22-10-5-4-9(6-8(10)3)19-11(20)13(15,16)14(17,18)12(19)21;;;/h3-7H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | XBLWLQITEBXAJC-UHFFFAOYSA-L |
| XLogP | 3.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|