C18H21Cl2O3PRu — CID 59154106
dichloro-[[5-[ethoxy(phenyl)phosphoryl]-2-propan-2-yloxyphenyl]methylidene]ruthenium (PubChem CID 59154106) has the molecular formula C18H21Cl2O3PRu and a molecular weight of 488.31 g/mol. Its IUPAC name is dichloro-[[5-[ethoxy(phenyl)phosphoryl]-2-propan-2-yloxyphenyl]methylidene]ruthenium.
| Compound Name | dichloro-[[5-[ethoxy(phenyl)phosphoryl]-2-propan-2-yloxyphenyl]methylidene]ruthenium |
|---|---|
| PubChem CID | 59154106 |
| Molecular Formula | C18H21Cl2O3PRu |
| Molecular Weight | 488.31 g/mol |
| Exact Mass | 487.96 |
| IUPAC Name | dichloro-[[5-[ethoxy(phenyl)phosphoryl]-2-propan-2-yloxyphenyl]methylidene]ruthenium |
| SMILES | CCOP(=O)(c1ccccc1)c1ccc(OC(C)C)c(C=[Ru](Cl)Cl)c1 |
| InChI | InChI=1S/C18H21O3P.2ClH.Ru/c1-5-20-22(19,16-9-7-6-8-10-16)17-11-12-18(15(4)13-17)21-14(2)3;;;/h4,6-14H,5H2,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | SXNFSVKMDOMXHK-UHFFFAOYSA-L |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|