C20H25O4P — CID 66742321
2-ethenyl-4-[ethoxy-(4-methoxyphenyl)phosphoryl]-1-propan-2-yloxybenzene (PubChem CID 66742321) has the molecular formula C20H25O4P and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-ethenyl-4-[ethoxy-(4-methoxyphenyl)phosphoryl]-1-propan-2-yloxybenzene.
| Compound Name | 2-ethenyl-4-[ethoxy-(4-methoxyphenyl)phosphoryl]-1-propan-2-yloxybenzene |
|---|---|
| PubChem CID | 66742321 |
| Molecular Formula | C20H25O4P |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-ethenyl-4-[ethoxy-(4-methoxyphenyl)phosphoryl]-1-propan-2-yloxybenzene |
| SMILES | C=Cc1cc(P(=O)(OCC)c2ccc(OC)cc2)ccc1OC(C)C |
| InChI | InChI=1S/C20H25O4P/c1-6-16-14-19(12-13-20(16)24-15(3)4)25(21,23-7-2)18-10-8-17(22-5)9-11-18/h6,8-15H,1,7H2,2-5H3 |
| InChIKey | DBYPMJRWLMOREA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|