C20H28O6 — CID 70577906
diethyl 2-[[2,5-di(propan-2-yloxy)phenyl]methylidene]propanedioate (PubChem CID 70577906) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is diethyl 2-[[2,5-di(propan-2-yloxy)phenyl]methylidene]propanedioate.
| Compound Name | diethyl 2-[[2,5-di(propan-2-yloxy)phenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 70577906 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | diethyl 2-[[2,5-di(propan-2-yloxy)phenyl]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=Cc1cc(OC(C)C)ccc1OC(C)C)C(=O)OCC |
| InChI | InChI=1S/C20H28O6/c1-7-23-19(21)17(20(22)24-8-2)12-15-11-16(25-13(3)4)9-10-18(15)26-14(5)6/h9-14H,7-8H2,1-6H3 |
| InChIKey | DZAXKWZFWSWPLF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|