C30H42O6 — CID 70017849
(E)-3-[2,5-di(propan-2-yloxy)phenyl]-1-[2,3,6-tri(propan-2-yloxy)phenyl]prop-2-en-1-one (PubChem CID 70017849) has the molecular formula C30H42O6 and a molecular weight of 498.66 g/mol. Its IUPAC name is (E)-3-[2,5-di(propan-2-yloxy)phenyl]-1-[2,3,6-tri(propan-2-yloxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[2,5-di(propan-2-yloxy)phenyl]-1-[2,3,6-tri(propan-2-yloxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70017849 |
| Molecular Formula | C30H42O6 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | (E)-3-[2,5-di(propan-2-yloxy)phenyl]-1-[2,3,6-tri(propan-2-yloxy)phenyl]prop-2-en-1-one |
| SMILES | CC(C)Oc1ccc(OC(C)C)c(/C=C/C(=O)c2c(OC(C)C)ccc(OC(C)C)c2OC(C)C)c1 |
| InChI | InChI=1S/C30H42O6/c1-18(2)32-24-12-14-26(33-19(3)4)23(17-24)11-13-25(31)29-27(34-20(5)6)15-16-28(35-21(7)8)30(29)36-22(9)10/h11-22H,1-10H3/b13-11+ |
| InChIKey | NCKICGMAJKCKGW-ACCUITESSA-N |
| XLogP | 7.52 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|