C23H28O6 — CID 147816382
(E)-1-(2,4-dimethoxy-3-methylphenyl)-3-[4-(1-hydroxyethoxy)-2-propan-2-yloxyphenyl]prop-2-en-1-one (PubChem CID 147816382) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is (E)-1-(2,4-dimethoxy-3-methylphenyl)-3-[4-(1-hydroxyethoxy)-2-propan-2-yloxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dimethoxy-3-methylphenyl)-3-[4-(1-hydroxyethoxy)-2-propan-2-yloxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 147816382 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (E)-1-(2,4-dimethoxy-3-methylphenyl)-3-[4-(1-hydroxyethoxy)-2-propan-2-yloxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(OC(C)O)cc2OC(C)C)c(OC)c1C |
| InChI | InChI=1S/C23H28O6/c1-14(2)28-22-13-18(29-16(4)24)9-7-17(22)8-11-20(25)19-10-12-21(26-5)15(3)23(19)27-6/h7-14,16,24H,1-6H3/b11-8+ |
| InChIKey | HOJPVYIPJKRPCR-DHZHZOJOSA-N |
| XLogP | 4.41 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|