C19H20O6 — CID 162624464
(E)-3-(2-hydroxy-5-methoxyphenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 162624464) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is (E)-3-(2-hydroxy-5-methoxyphenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-hydroxy-5-methoxyphenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 162624464 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (E)-3-(2-hydroxy-5-methoxyphenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(O)c(/C=C/C(=O)c2ccc(OC)c(OC)c2OC)c1 |
| InChI | InChI=1S/C19H20O6/c1-22-13-6-9-15(20)12(11-13)5-8-16(21)14-7-10-17(23-2)19(25-4)18(14)24-3/h5-11,20H,1-4H3/b8-5+ |
| InChIKey | NMINBNUCQHXHSE-VMPITWQZSA-N |
| XLogP | 3.32 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|