C18H17IO5 — CID 162624440
(E)-3-(2-hydroxy-5-iodophenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 162624440) has the molecular formula C18H17IO5 and a molecular weight of 440.23 g/mol. Its IUPAC name is (E)-3-(2-hydroxy-5-iodophenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-hydroxy-5-iodophenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 162624440 |
| Molecular Formula | C18H17IO5 |
| Molecular Weight | 440.23 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | (E)-3-(2-hydroxy-5-iodophenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2cc(I)ccc2O)c(OC)c1OC |
| InChI | InChI=1S/C18H17IO5/c1-22-16-9-6-13(17(23-2)18(16)24-3)15(21)7-4-11-10-12(19)5-8-14(11)20/h4-10,20H,1-3H3/b7-4+ |
| InChIKey | WOZRSXZZIOCUSC-QPJJXVBHSA-N |
| XLogP | 3.92 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|