C39H60O7 — CID 91579414
3-(2,5-dibutoxyphenyl)-1-(2,3,5,6-tetrabutoxyphenyl)prop-2-en-1-one (PubChem CID 91579414) has the molecular formula C39H60O7 and a molecular weight of 640.90 g/mol. Its IUPAC name is 3-(2,5-dibutoxyphenyl)-1-(2,3,5,6-tetrabutoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(2,5-dibutoxyphenyl)-1-(2,3,5,6-tetrabutoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 91579414 |
| Molecular Formula | C39H60O7 |
| Molecular Weight | 640.90 g/mol |
| Exact Mass | 640.43 |
| IUPAC Name | 3-(2,5-dibutoxyphenyl)-1-(2,3,5,6-tetrabutoxyphenyl)prop-2-en-1-one |
| SMILES | CCCCOc1ccc(OCCCC)c(C=CC(=O)c2c(OCCCC)c(OCCCC)cc(OCCCC)c2OCCCC)c1 |
| InChI | InChI=1S/C39H60O7/c1-7-13-23-41-32-20-22-34(42-24-14-8-2)31(29-32)19-21-33(40)37-38(45-27-17-11-5)35(43-25-15-9-3)30-36(44-26-16-10-4)39(37)46-28-18-12-6/h19-22,29-30H,7-18,23-28H2,1-6H3 |
| InChIKey | XXJJNBJGIZKEHQ-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.90 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|