C31H44O6 — CID 89104241
(E)-1-(2,4-dibutoxy-6-hydroxyphenyl)-3-(3,4-dibutoxyphenyl)prop-2-en-1-one (PubChem CID 89104241) has the molecular formula C31H44O6 and a molecular weight of 512.69 g/mol. Its IUPAC name is (E)-1-(2,4-dibutoxy-6-hydroxyphenyl)-3-(3,4-dibutoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dibutoxy-6-hydroxyphenyl)-3-(3,4-dibutoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 89104241 |
| Molecular Formula | C31H44O6 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | (E)-1-(2,4-dibutoxy-6-hydroxyphenyl)-3-(3,4-dibutoxyphenyl)prop-2-en-1-one |
| SMILES | CCCCOc1cc(O)c(C(=O)/C=C/c2ccc(OCCCC)c(OCCCC)c2)c(OCCCC)c1 |
| InChI | InChI=1S/C31H44O6/c1-5-9-17-34-25-22-27(33)31(30(23-25)37-20-12-8-4)26(32)15-13-24-14-16-28(35-18-10-6-2)29(21-24)36-19-11-7-3/h13-16,21-23,33H,5-12,17-20H2,1-4H3/b15-13+ |
| InChIKey | PPUOLBSFMTZWJO-FYWRMAATSA-N |
| XLogP | 8.00 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|