C31H46N2O5 — CID 162665033
(E)-1-[4-[4-(diethylamino)butoxy]-2,6-dihydroxyphenyl]-3-[4-[4-(diethylamino)butoxy]phenyl]prop-2-en-1-one (PubChem CID 162665033) has the molecular formula C31H46N2O5 and a molecular weight of 526.72 g/mol. Its IUPAC name is (E)-1-[4-[4-(diethylamino)butoxy]-2,6-dihydroxyphenyl]-3-[4-[4-(diethylamino)butoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-[4-(diethylamino)butoxy]-2,6-dihydroxyphenyl]-3-[4-[4-(diethylamino)butoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 162665033 |
| Molecular Formula | C31H46N2O5 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | (E)-1-[4-[4-(diethylamino)butoxy]-2,6-dihydroxyphenyl]-3-[4-[4-(diethylamino)butoxy]phenyl]prop-2-en-1-one |
| SMILES | CCN(CC)CCCCOc1ccc(/C=C/C(=O)c2c(O)cc(OCCCCN(CC)CC)cc2O)cc1 |
| InChI | InChI=1S/C31H46N2O5/c1-5-32(6-2)19-9-11-21-37-26-16-13-25(14-17-26)15-18-28(34)31-29(35)23-27(24-30(31)36)38-22-12-10-20-33(7-3)8-4/h13-18,23-24,35-36H,5-12,19-22H2,1-4H3/b18-15+ |
| InChIKey | OGHSLHAXPVLHBD-OBGWFSINSA-N |
| XLogP | 6.00 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|