C35H54N2O4 — CID 155510534
(E)-1-[4-[6-(diethylamino)hexoxy]-2-hydroxyphenyl]-3-[4-[6-(diethylamino)hexoxy]phenyl]prop-2-en-1-one (PubChem CID 155510534) has the molecular formula C35H54N2O4 and a molecular weight of 566.83 g/mol. Its IUPAC name is (E)-1-[4-[6-(diethylamino)hexoxy]-2-hydroxyphenyl]-3-[4-[6-(diethylamino)hexoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-[6-(diethylamino)hexoxy]-2-hydroxyphenyl]-3-[4-[6-(diethylamino)hexoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155510534 |
| Molecular Formula | C35H54N2O4 |
| Molecular Weight | 566.83 g/mol |
| Exact Mass | 566.41 |
| IUPAC Name | (E)-1-[4-[6-(diethylamino)hexoxy]-2-hydroxyphenyl]-3-[4-[6-(diethylamino)hexoxy]phenyl]prop-2-en-1-one |
| SMILES | CCN(CC)CCCCCCOc1ccc(/C=C/C(=O)c2ccc(OCCCCCCN(CC)CC)cc2O)cc1 |
| InChI | InChI=1S/C35H54N2O4/c1-5-36(6-2)25-13-9-11-15-27-40-31-20-17-30(18-21-31)19-24-34(38)33-23-22-32(29-35(33)39)41-28-16-12-10-14-26-37(7-3)8-4/h17-24,29,39H,5-16,25-28H2,1-4H3/b24-19+ |
| InChIKey | SYWOSMAZYBMFGU-LYBHJNIJSA-N |
| XLogP | 7.85 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.83 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|