C23H27BrO3 — CID 4191103
3-(4-bromophenyl)-1-(3,4-dibutoxyphenyl)prop-2-en-1-one (PubChem CID 4191103) has the molecular formula C23H27BrO3 and a molecular weight of 431.37 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-(3,4-dibutoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(4-bromophenyl)-1-(3,4-dibutoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4191103 |
| Molecular Formula | C23H27BrO3 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 3-(4-bromophenyl)-1-(3,4-dibutoxyphenyl)prop-2-en-1-one |
| SMILES | CCCCOc1ccc(C(=O)C=Cc2ccc(Br)cc2)cc1OCCCC |
| InChI | InChI=1S/C23H27BrO3/c1-3-5-15-26-22-14-10-19(17-23(22)27-16-6-4-2)21(25)13-9-18-7-11-20(24)12-8-18/h7-14,17H,3-6,15-16H2,1-2H3 |
| InChIKey | AUVKENHAIMCNGZ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|