C41H64O5 — CID 70017559
3-(5-ethyl-2-hexoxyphenyl)-1-(2,3,6-trihexoxyphenyl)prop-2-en-1-one (PubChem CID 70017559) has the molecular formula C41H64O5 and a molecular weight of 636.96 g/mol. Its IUPAC name is 3-(5-ethyl-2-hexoxyphenyl)-1-(2,3,6-trihexoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(5-ethyl-2-hexoxyphenyl)-1-(2,3,6-trihexoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 70017559 |
| Molecular Formula | C41H64O5 |
| Molecular Weight | 636.96 g/mol |
| Exact Mass | 636.48 |
| IUPAC Name | 3-(5-ethyl-2-hexoxyphenyl)-1-(2,3,6-trihexoxyphenyl)prop-2-en-1-one |
| SMILES | CCCCCCOc1ccc(CC)cc1C=CC(=O)c1c(OCCCCCC)ccc(OCCCCCC)c1OCCCCCC |
| InChI | InChI=1S/C41H64O5/c1-6-11-15-19-29-43-37-26-23-34(10-5)33-35(37)24-25-36(42)40-38(44-30-20-16-12-7-2)27-28-39(45-31-21-17-13-8-3)41(40)46-32-22-18-14-9-4/h23-28,33H,6-22,29-32H2,1-5H3 |
| InChIKey | INEPMOMGFYSXNG-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.96 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|