C25H32O3 — CID 70018099
(E)-3-[5-ethyl-2-(2-methylpropoxy)phenyl]-1-[2-(2-methylpropoxy)phenyl]prop-2-en-1-one (PubChem CID 70018099) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is (E)-3-[5-ethyl-2-(2-methylpropoxy)phenyl]-1-[2-(2-methylpropoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[5-ethyl-2-(2-methylpropoxy)phenyl]-1-[2-(2-methylpropoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70018099 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (E)-3-[5-ethyl-2-(2-methylpropoxy)phenyl]-1-[2-(2-methylpropoxy)phenyl]prop-2-en-1-one |
| SMILES | CCc1ccc(OCC(C)C)c(/C=C/C(=O)c2ccccc2OCC(C)C)c1 |
| InChI | InChI=1S/C25H32O3/c1-6-20-11-14-24(27-16-18(2)3)21(15-20)12-13-23(26)22-9-7-8-10-25(22)28-17-19(4)5/h7-15,18-19H,6,16-17H2,1-5H3/b13-12+ |
| InChIKey | APYCHHIJTQGZKD-OUKQBFOZSA-N |
| XLogP | 6.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|