C37H56O5 — CID 70017105
3-(5-ethyl-2-pentan-2-yloxyphenyl)-1-[2,3,5-tri(pentan-2-yloxy)phenyl]prop-2-en-1-one (PubChem CID 70017105) has the molecular formula C37H56O5 and a molecular weight of 580.85 g/mol. Its IUPAC name is 3-(5-ethyl-2-pentan-2-yloxyphenyl)-1-[2,3,5-tri(pentan-2-yloxy)phenyl]prop-2-en-1-one.
| Compound Name | 3-(5-ethyl-2-pentan-2-yloxyphenyl)-1-[2,3,5-tri(pentan-2-yloxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70017105 |
| Molecular Formula | C37H56O5 |
| Molecular Weight | 580.85 g/mol |
| Exact Mass | 580.41 |
| IUPAC Name | 3-(5-ethyl-2-pentan-2-yloxyphenyl)-1-[2,3,5-tri(pentan-2-yloxy)phenyl]prop-2-en-1-one |
| SMILES | CCCC(C)Oc1cc(OC(C)CCC)c(OC(C)CCC)c(C(=O)C=Cc2cc(CC)ccc2OC(C)CCC)c1 |
| InChI | InChI=1S/C37H56O5/c1-10-15-26(6)39-32-24-33(37(42-29(9)18-13-4)36(25-32)41-28(8)17-12-3)34(38)21-20-31-23-30(14-5)19-22-35(31)40-27(7)16-11-2/h19-29H,10-18H2,1-9H3 |
| InChIKey | KCHRBGKGXDYTKN-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.85 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|