C41H64O7 — CID 70018943
3-[3-methoxy-2,5-di(pentan-2-yloxy)phenyl]-1-[2,3,6-tri(pentan-2-yloxy)phenyl]prop-2-en-1-one (PubChem CID 70018943) has the molecular formula C41H64O7 and a molecular weight of 668.96 g/mol. Its IUPAC name is 3-[3-methoxy-2,5-di(pentan-2-yloxy)phenyl]-1-[2,3,6-tri(pentan-2-yloxy)phenyl]prop-2-en-1-one.
| Compound Name | 3-[3-methoxy-2,5-di(pentan-2-yloxy)phenyl]-1-[2,3,6-tri(pentan-2-yloxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70018943 |
| Molecular Formula | C41H64O7 |
| Molecular Weight | 668.96 g/mol |
| Exact Mass | 668.47 |
| IUPAC Name | 3-[3-methoxy-2,5-di(pentan-2-yloxy)phenyl]-1-[2,3,6-tri(pentan-2-yloxy)phenyl]prop-2-en-1-one |
| SMILES | CCCC(C)Oc1cc(C=CC(=O)c2c(OC(C)CCC)ccc(OC(C)CCC)c2OC(C)CCC)c(OC(C)CCC)c(OC)c1 |
| InChI | InChI=1S/C41H64O7/c1-12-17-28(6)44-34-26-33(40(38(27-34)43-11)47-31(9)20-15-4)22-23-35(42)39-36(45-29(7)18-13-2)24-25-37(46-30(8)19-14-3)41(39)48-32(10)21-16-5/h22-32H,12-21H2,1-11H3 |
| InChIKey | VPLIBLAQIAWERD-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.96 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|